C16H20N2O6S2 — CID 27658093
3,4-diethoxy-N-(4-sulfamoylphenyl)benzenesulfonamide (PubChem CID 27658093) has the molecular formula C16H20N2O6S2 and a molecular weight of 400.48 g/mol. Its IUPAC name is 3,4-diethoxy-N-(4-sulfamoylphenyl)benzenesulfonamide.
| Compound Name | 3,4-diethoxy-N-(4-sulfamoylphenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 27658093 |
| Molecular Formula | C16H20N2O6S2 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.08 |
| IUPAC Name | 3,4-diethoxy-N-(4-sulfamoylphenyl)benzenesulfonamide |
| SMILES | CCOc1ccc(S(=O)(=O)Nc2ccc(S(N)(=O)=O)cc2)cc1OCC |
| InChI | InChI=1S/C16H20N2O6S2/c1-3-23-15-10-9-14(11-16(15)24-4-2)26(21,22)18-12-5-7-13(8-6-12)25(17,19)20/h5-11,18H,3-4H2,1-2H3,(H2,17,19,20) |
| InChIKey | FPEHSBYGLQJGIF-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 124.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |