C10H16N2O4S — CID 112573189
1,2-diethoxy-4-(sulfamoylamino)benzene (PubChem CID 112573189) has the molecular formula C10H16N2O4S and a molecular weight of 260.31 g/mol. Its IUPAC name is 1,2-diethoxy-4-(sulfamoylamino)benzene.
| Compound Name | 1,2-diethoxy-4-(sulfamoylamino)benzene |
|---|---|
| PubChem CID | 112573189 |
| Molecular Formula | C10H16N2O4S |
| Molecular Weight | 260.31 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | 1,2-diethoxy-4-(sulfamoylamino)benzene |
| SMILES | CCOc1ccc(NS(N)(=O)=O)cc1OCC |
| InChI | InChI=1S/C10H16N2O4S/c1-3-15-9-6-5-8(12-17(11,13)14)7-10(9)16-4-2/h5-7,12H,3-4H2,1-2H3,(H2,11,13,14) |
| InChIKey | JXTDZDAXYDTXMM-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.31 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |