C13H22N2O5S — CID 166240379
2-ethoxy-1-methoxy-4-[[2-methoxyethyl(methyl)sulfamoyl]amino]benzene (PubChem CID 166240379) has the molecular formula C13H22N2O5S and a molecular weight of 318.40 g/mol. Its IUPAC name is 2-ethoxy-1-methoxy-4-[[2-methoxyethyl(methyl)sulfamoyl]amino]benzene.
| Compound Name | 2-ethoxy-1-methoxy-4-[[2-methoxyethyl(methyl)sulfamoyl]amino]benzene |
|---|---|
| PubChem CID | 166240379 |
| Molecular Formula | C13H22N2O5S |
| Molecular Weight | 318.40 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | 2-ethoxy-1-methoxy-4-[[2-methoxyethyl(methyl)sulfamoyl]amino]benzene |
| SMILES | CCOc1cc(NS(=O)(=O)N(C)CCOC)ccc1OC |
| InChI | InChI=1S/C13H22N2O5S/c1-5-20-13-10-11(6-7-12(13)19-4)14-21(16,17)15(2)8-9-18-3/h6-7,10,14H,5,8-9H2,1-4H3 |
| InChIKey | IXKJEOWYJPVDPC-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.40 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |