C19H23NO7S — CID 55624593
methyl 3-[[4-methoxy-3-(2-methoxyethoxy)phenyl]sulfamoyl]-4-methylbenzoate (PubChem CID 55624593) has the molecular formula C19H23NO7S and a molecular weight of 409.46 g/mol. Its IUPAC name is methyl 3-[[4-methoxy-3-(2-methoxyethoxy)phenyl]sulfamoyl]-4-methylbenzoate.
| Compound Name | methyl 3-[[4-methoxy-3-(2-methoxyethoxy)phenyl]sulfamoyl]-4-methylbenzoate |
|---|---|
| PubChem CID | 55624593 |
| Molecular Formula | C19H23NO7S |
| Molecular Weight | 409.46 g/mol |
| Exact Mass | 409.12 |
| IUPAC Name | methyl 3-[[4-methoxy-3-(2-methoxyethoxy)phenyl]sulfamoyl]-4-methylbenzoate |
| SMILES | COCCOc1cc(NS(=O)(=O)c2cc(C(=O)OC)ccc2C)ccc1OC |
| InChI | InChI=1S/C19H23NO7S/c1-13-5-6-14(19(21)26-4)11-18(13)28(22,23)20-15-7-8-16(25-3)17(12-15)27-10-9-24-2/h5-8,11-12,20H,9-10H2,1-4H3 |
| InChIKey | ABQBUHWMRXASDH-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.46 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|