C18H21NO8S — CID 55624724
4-methoxy-3-[[4-methoxy-3-(2-methoxyethoxy)phenyl]sulfamoyl]benzoic acid (PubChem CID 55624724) has the molecular formula C18H21NO8S and a molecular weight of 411.43 g/mol. Its IUPAC name is 4-methoxy-3-[[4-methoxy-3-(2-methoxyethoxy)phenyl]sulfamoyl]benzoic acid.
| Compound Name | 4-methoxy-3-[[4-methoxy-3-(2-methoxyethoxy)phenyl]sulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 55624724 |
| Molecular Formula | C18H21NO8S |
| Molecular Weight | 411.43 g/mol |
| Exact Mass | 411.10 |
| IUPAC Name | 4-methoxy-3-[[4-methoxy-3-(2-methoxyethoxy)phenyl]sulfamoyl]benzoic acid |
| SMILES | COCCOc1cc(NS(=O)(=O)c2cc(C(=O)O)ccc2OC)ccc1OC |
| InChI | InChI=1S/C18H21NO8S/c1-24-8-9-27-16-11-13(5-7-14(16)25-2)19-28(22,23)17-10-12(18(20)21)4-6-15(17)26-3/h4-7,10-11,19H,8-9H2,1-3H3,(H,20,21) |
| InChIKey | OFKLTPLMTPIZSF-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 120.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.43 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|