C16H16FNO6S — CID 56809084
3-[(3,4-dimethoxyphenyl)sulfamoyl]-5-fluoro-4-methylbenzoic acid (PubChem CID 56809084) has the molecular formula C16H16FNO6S and a molecular weight of 369.37 g/mol. Its IUPAC name is 3-[(3,4-dimethoxyphenyl)sulfamoyl]-5-fluoro-4-methylbenzoic acid.
| Compound Name | 3-[(3,4-dimethoxyphenyl)sulfamoyl]-5-fluoro-4-methylbenzoic acid |
|---|---|
| PubChem CID | 56809084 |
| Molecular Formula | C16H16FNO6S |
| Molecular Weight | 369.37 g/mol |
| Exact Mass | 369.07 |
| IUPAC Name | 3-[(3,4-dimethoxyphenyl)sulfamoyl]-5-fluoro-4-methylbenzoic acid |
| SMILES | COc1ccc(NS(=O)(=O)c2cc(C(=O)O)cc(F)c2C)cc1OC |
| InChI | InChI=1S/C16H16FNO6S/c1-9-12(17)6-10(16(19)20)7-15(9)25(21,22)18-11-4-5-13(23-2)14(8-11)24-3/h4-8,18H,1-3H3,(H,19,20) |
| InChIKey | FYTWXKLSFDWVQE-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.37 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |