C16H15FN2O6S — CID 24656737
3-[(3-acetamido-4-fluorophenyl)sulfamoyl]-4-methoxybenzoic acid (PubChem CID 24656737) has the molecular formula C16H15FN2O6S and a molecular weight of 382.37 g/mol. Its IUPAC name is 3-[(3-acetamido-4-fluorophenyl)sulfamoyl]-4-methoxybenzoic acid.
| Compound Name | 3-[(3-acetamido-4-fluorophenyl)sulfamoyl]-4-methoxybenzoic acid |
|---|---|
| PubChem CID | 24656737 |
| Molecular Formula | C16H15FN2O6S |
| Molecular Weight | 382.37 g/mol |
| Exact Mass | 382.06 |
| IUPAC Name | 3-[(3-acetamido-4-fluorophenyl)sulfamoyl]-4-methoxybenzoic acid |
| SMILES | COc1ccc(C(=O)O)cc1S(=O)(=O)Nc1ccc(F)c(NC(C)=O)c1 |
| InChI | InChI=1S/C16H15FN2O6S/c1-9(20)18-13-8-11(4-5-12(13)17)19-26(23,24)15-7-10(16(21)22)3-6-14(15)25-2/h3-8,19H,1-2H3,(H,18,20)(H,21,22) |
| InChIKey | JHEAJNBKIZAXEF-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 121.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.37 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |