C17H18N2O6S — CID 24580838
3-[[4-(dimethylcarbamoyl)phenyl]sulfamoyl]-4-methoxybenzoic acid (PubChem CID 24580838) has the molecular formula C17H18N2O6S and a molecular weight of 378.41 g/mol. Its IUPAC name is 3-[[4-(dimethylcarbamoyl)phenyl]sulfamoyl]-4-methoxybenzoic acid.
| Compound Name | 3-[[4-(dimethylcarbamoyl)phenyl]sulfamoyl]-4-methoxybenzoic acid |
|---|---|
| PubChem CID | 24580838 |
| Molecular Formula | C17H18N2O6S |
| Molecular Weight | 378.41 g/mol |
| Exact Mass | 378.09 |
| IUPAC Name | 3-[[4-(dimethylcarbamoyl)phenyl]sulfamoyl]-4-methoxybenzoic acid |
| SMILES | COc1ccc(C(=O)O)cc1S(=O)(=O)Nc1ccc(C(=O)N(C)C)cc1 |
| InChI | InChI=1S/C17H18N2O6S/c1-19(2)16(20)11-4-7-13(8-5-11)18-26(23,24)15-10-12(17(21)22)6-9-14(15)25-3/h4-10,18H,1-3H3,(H,21,22) |
| InChIKey | SVMIXCISCBGDJQ-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.41 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |