C15H15NO6S — CID 777278
4-methoxy-3-[(2-methoxyphenyl)sulfamoyl]benzoic acid (PubChem CID 777278) has the molecular formula C15H15NO6S and a molecular weight of 337.35 g/mol. Its IUPAC name is 4-methoxy-3-[(2-methoxyphenyl)sulfamoyl]benzoic acid.
| Compound Name | 4-methoxy-3-[(2-methoxyphenyl)sulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 777278 |
| Molecular Formula | C15H15NO6S |
| Molecular Weight | 337.35 g/mol |
| Exact Mass | 337.06 |
| IUPAC Name | 4-methoxy-3-[(2-methoxyphenyl)sulfamoyl]benzoic acid |
| SMILES | COc1ccccc1NS(=O)(=O)c1cc(C(=O)O)ccc1OC |
| InChI | InChI=1S/C15H15NO6S/c1-21-12-6-4-3-5-11(12)16-23(19,20)14-9-10(15(17)18)7-8-13(14)22-2/h3-9,16H,1-2H3,(H,17,18) |
| InChIKey | GIWYBCYKWNZZNG-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.35 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |