C15H15NO7S — CID 7720378
4-[(2,5-dimethoxyphenyl)sulfonylamino]-3-hydroxybenzoic acid (PubChem CID 7720378) has the molecular formula C15H15NO7S and a molecular weight of 353.35 g/mol. Its IUPAC name is 4-[(2,5-dimethoxyphenyl)sulfonylamino]-3-hydroxybenzoic acid.
| Compound Name | 4-[(2,5-dimethoxyphenyl)sulfonylamino]-3-hydroxybenzoic acid |
|---|---|
| PubChem CID | 7720378 |
| Molecular Formula | C15H15NO7S |
| Molecular Weight | 353.35 g/mol |
| Exact Mass | 353.06 |
| IUPAC Name | 4-[(2,5-dimethoxyphenyl)sulfonylamino]-3-hydroxybenzoic acid |
| SMILES | COc1ccc(OC)c(S(=O)(=O)Nc2ccc(C(=O)O)cc2O)c1 |
| InChI | InChI=1S/C15H15NO7S/c1-22-10-4-6-13(23-2)14(8-10)24(20,21)16-11-5-3-9(15(18)19)7-12(11)17/h3-8,16-17H,1-2H3,(H,18,19) |
| InChIKey | ILSGOPAMUMZZGS-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 122.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.35 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|