C21H17NO8S — CID 56507584
3-[(5-carboxy-2-methoxyphenyl)sulfonylamino]-4-phenoxybenzoic acid (PubChem CID 56507584) has the molecular formula C21H17NO8S and a molecular weight of 443.43 g/mol. Its IUPAC name is 3-[(5-carboxy-2-methoxyphenyl)sulfonylamino]-4-phenoxybenzoic acid.
| Compound Name | 3-[(5-carboxy-2-methoxyphenyl)sulfonylamino]-4-phenoxybenzoic acid |
|---|---|
| PubChem CID | 56507584 |
| Molecular Formula | C21H17NO8S |
| Molecular Weight | 443.43 g/mol |
| Exact Mass | 443.07 |
| IUPAC Name | 3-[(5-carboxy-2-methoxyphenyl)sulfonylamino]-4-phenoxybenzoic acid |
| SMILES | COc1ccc(C(=O)O)cc1S(=O)(=O)Nc1cc(C(=O)O)ccc1Oc1ccccc1 |
| InChI | InChI=1S/C21H17NO8S/c1-29-18-10-8-14(21(25)26)12-19(18)31(27,28)22-16-11-13(20(23)24)7-9-17(16)30-15-5-3-2-4-6-15/h2-12,22H,1H3,(H,23,24)(H,25,26) |
| InChIKey | FITZBYGYFZQILS-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 139.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.43 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |