C20H14N2O5S — CID 51135610
3-[(4-cyanophenyl)sulfonylamino]-4-phenoxybenzoic acid (PubChem CID 51135610) has the molecular formula C20H14N2O5S and a molecular weight of 394.41 g/mol. Its IUPAC name is 3-[(4-cyanophenyl)sulfonylamino]-4-phenoxybenzoic acid.
| Compound Name | 3-[(4-cyanophenyl)sulfonylamino]-4-phenoxybenzoic acid |
|---|---|
| PubChem CID | 51135610 |
| Molecular Formula | C20H14N2O5S |
| Molecular Weight | 394.41 g/mol |
| Exact Mass | 394.06 |
| IUPAC Name | 3-[(4-cyanophenyl)sulfonylamino]-4-phenoxybenzoic acid |
| SMILES | N#Cc1ccc(S(=O)(=O)Nc2cc(C(=O)O)ccc2Oc2ccccc2)cc1 |
| InChI | InChI=1S/C20H14N2O5S/c21-13-14-6-9-17(10-7-14)28(25,26)22-18-12-15(20(23)24)8-11-19(18)27-16-4-2-1-3-5-16/h1-12,22H,(H,23,24) |
| InChIKey | BMAOCUHNSLISQZ-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 116.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.41 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |