C21H14N2O7S — CID 71067312
5-(3-carboxyphenoxy)-2-[(4-cyanophenyl)sulfonylamino]benzoic acid (PubChem CID 71067312) has the molecular formula C21H14N2O7S and a molecular weight of 438.42 g/mol. Its IUPAC name is 5-(3-carboxyphenoxy)-2-[(4-cyanophenyl)sulfonylamino]benzoic acid.
| Compound Name | 5-(3-carboxyphenoxy)-2-[(4-cyanophenyl)sulfonylamino]benzoic acid |
|---|---|
| PubChem CID | 71067312 |
| Molecular Formula | C21H14N2O7S |
| Molecular Weight | 438.42 g/mol |
| Exact Mass | 438.05 |
| IUPAC Name | 5-(3-carboxyphenoxy)-2-[(4-cyanophenyl)sulfonylamino]benzoic acid |
| SMILES | N#Cc1ccc(S(=O)(=O)Nc2ccc(Oc3cccc(C(=O)O)c3)cc2C(=O)O)cc1 |
| InChI | InChI=1S/C21H14N2O7S/c22-12-13-4-7-17(8-5-13)31(28,29)23-19-9-6-16(11-18(19)21(26)27)30-15-3-1-2-14(10-15)20(24)25/h1-11,23H,(H,24,25)(H,26,27) |
| InChIKey | JCTXDZJUVGFRLW-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 153.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.42 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |