C30H28F2N2O6S — CID 44515682
2-[(4-butoxyphenyl)sulfonylamino]-5-[3-[(2,3-difluorophenyl)methylamino]phenoxy]benzoic acid (PubChem CID 44515682) has the molecular formula C30H28F2N2O6S and a molecular weight of 582.63 g/mol. Its IUPAC name is 2-[(4-butoxyphenyl)sulfonylamino]-5-[3-[(2,3-difluorophenyl)methylamino]phenoxy]benzoic acid.
| Compound Name | 2-[(4-butoxyphenyl)sulfonylamino]-5-[3-[(2,3-difluorophenyl)methylamino]phenoxy]benzoic acid |
|---|---|
| PubChem CID | 44515682 |
| Molecular Formula | C30H28F2N2O6S |
| Molecular Weight | 582.63 g/mol |
| Exact Mass | 582.16 |
| IUPAC Name | 2-[(4-butoxyphenyl)sulfonylamino]-5-[3-[(2,3-difluorophenyl)methylamino]phenoxy]benzoic acid |
| SMILES | CCCCOc1ccc(S(=O)(=O)Nc2ccc(Oc3cccc(NCc4cccc(F)c4F)c3)cc2C(=O)O)cc1 |
| InChI | InChI=1S/C30H28F2N2O6S/c1-2-3-16-39-22-10-13-25(14-11-22)41(37,38)34-28-15-12-24(18-26(28)30(35)36)40-23-8-5-7-21(17-23)33-19-20-6-4-9-27(31)29(20)32/h4-15,17-18,33-34H,2-3,16,19H2,1H3,(H,35,36) |
| InChIKey | ZLSRINIWEFVOAT-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.63 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|