C32H34N2O8S2 — CID 59566191
2-[(4-methylphenyl)sulfonylamino]-5-[4-[(4-methylphenyl)sulfonylamino]-3-pentoxyphenoxy]benzoic acid (PubChem CID 59566191) has the molecular formula C32H34N2O8S2 and a molecular weight of 638.76 g/mol. Its IUPAC name is 2-[(4-methylphenyl)sulfonylamino]-5-[4-[(4-methylphenyl)sulfonylamino]-3-pentoxyphenoxy]benzoic acid.
| Compound Name | 2-[(4-methylphenyl)sulfonylamino]-5-[4-[(4-methylphenyl)sulfonylamino]-3-pentoxyphenoxy]benzoic acid |
|---|---|
| PubChem CID | 59566191 |
| Molecular Formula | C32H34N2O8S2 |
| Molecular Weight | 638.76 g/mol |
| Exact Mass | 638.18 |
| IUPAC Name | 2-[(4-methylphenyl)sulfonylamino]-5-[4-[(4-methylphenyl)sulfonylamino]-3-pentoxyphenoxy]benzoic acid |
| SMILES | CCCCCOc1cc(Oc2ccc(NS(=O)(=O)c3ccc(C)cc3)c(C(=O)O)c2)ccc1NS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C32H34N2O8S2/c1-4-5-6-19-41-31-21-25(12-18-30(31)34-44(39,40)27-15-9-23(3)10-16-27)42-24-11-17-29(28(20-24)32(35)36)33-43(37,38)26-13-7-22(2)8-14-26/h7-18,20-21,33-34H,4-6,19H2,1-3H3,(H,35,36) |
| InChIKey | QRJTUNOFNRGBRF-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 148.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.76 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|