C25H28N2O4S — CID 4940984
2-butoxy-N-[4-[(2,4-dimethylphenyl)sulfamoyl]phenyl]benzamide (PubChem CID 4940984) has the molecular formula C25H28N2O4S and a molecular weight of 452.58 g/mol. Its IUPAC name is 2-butoxy-N-[4-[(2,4-dimethylphenyl)sulfamoyl]phenyl]benzamide.
| Compound Name | 2-butoxy-N-[4-[(2,4-dimethylphenyl)sulfamoyl]phenyl]benzamide |
|---|---|
| PubChem CID | 4940984 |
| Molecular Formula | C25H28N2O4S |
| Molecular Weight | 452.58 g/mol |
| Exact Mass | 452.18 |
| IUPAC Name | 2-butoxy-N-[4-[(2,4-dimethylphenyl)sulfamoyl]phenyl]benzamide |
| SMILES | CCCCOc1ccccc1C(=O)Nc1ccc(S(=O)(=O)Nc2ccc(C)cc2C)cc1 |
| InChI | InChI=1S/C25H28N2O4S/c1-4-5-16-31-24-9-7-6-8-22(24)25(28)26-20-11-13-21(14-12-20)32(29,30)27-23-15-10-18(2)17-19(23)3/h6-15,17,27H,4-5,16H2,1-3H3,(H,26,28) |
| InChIKey | XTFCUGDJXDDRPQ-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.58 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|