C27H31N3O4S2 — CID 4944514
N-[[4-[(2,4-dimethylphenyl)sulfamoyl]phenyl]carbamothioyl]-2-(3-methylbutoxy)benzamide (PubChem CID 4944514) has the molecular formula C27H31N3O4S2 and a molecular weight of 525.70 g/mol. Its IUPAC name is N-[[4-[(2,4-dimethylphenyl)sulfamoyl]phenyl]carbamothioyl]-2-(3-methylbutoxy)benzamide.
| Compound Name | N-[[4-[(2,4-dimethylphenyl)sulfamoyl]phenyl]carbamothioyl]-2-(3-methylbutoxy)benzamide |
|---|---|
| PubChem CID | 4944514 |
| Molecular Formula | C27H31N3O4S2 |
| Molecular Weight | 525.70 g/mol |
| Exact Mass | 525.18 |
| IUPAC Name | N-[[4-[(2,4-dimethylphenyl)sulfamoyl]phenyl]carbamothioyl]-2-(3-methylbutoxy)benzamide |
| SMILES | Cc1ccc(NS(=O)(=O)c2ccc(NC(=S)NC(=O)c3ccccc3OCCC(C)C)cc2)c(C)c1 |
| InChI | InChI=1S/C27H31N3O4S2/c1-18(2)15-16-34-25-8-6-5-7-23(25)26(31)29-27(35)28-21-10-12-22(13-11-21)36(32,33)30-24-14-9-19(3)17-20(24)4/h5-14,17-18,30H,15-16H2,1-4H3,(H2,28,29,31,35) |
| InChIKey | XZXYFONPJOKKLL-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.70 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|