C29H28N2O5S — CID 4954338
N-[4-[(2,4-dimethylphenyl)sulfamoyl]phenyl]-2-(2-phenoxyethoxy)benzamide (PubChem CID 4954338) has the molecular formula C29H28N2O5S and a molecular weight of 516.62 g/mol. Its IUPAC name is N-[4-[(2,4-dimethylphenyl)sulfamoyl]phenyl]-2-(2-phenoxyethoxy)benzamide.
| Compound Name | N-[4-[(2,4-dimethylphenyl)sulfamoyl]phenyl]-2-(2-phenoxyethoxy)benzamide |
|---|---|
| PubChem CID | 4954338 |
| Molecular Formula | C29H28N2O5S |
| Molecular Weight | 516.62 g/mol |
| Exact Mass | 516.17 |
| IUPAC Name | N-[4-[(2,4-dimethylphenyl)sulfamoyl]phenyl]-2-(2-phenoxyethoxy)benzamide |
| SMILES | Cc1ccc(NS(=O)(=O)c2ccc(NC(=O)c3ccccc3OCCOc3ccccc3)cc2)c(C)c1 |
| InChI | InChI=1S/C29H28N2O5S/c1-21-12-17-27(22(2)20-21)31-37(33,34)25-15-13-23(14-16-25)30-29(32)26-10-6-7-11-28(26)36-19-18-35-24-8-4-3-5-9-24/h3-17,20,31H,18-19H2,1-2H3,(H,30,32) |
| InChIKey | XPPJHPDOIGMFPE-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.62 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|