C29H28N2O4S — CID 19628059
N-[4-[(3,4-dimethylphenyl)sulfamoyl]phenyl]-2-(2-phenylethoxy)benzamide (PubChem CID 19628059) has the molecular formula C29H28N2O4S and a molecular weight of 500.62 g/mol. Its IUPAC name is N-[4-[(3,4-dimethylphenyl)sulfamoyl]phenyl]-2-(2-phenylethoxy)benzamide.
| Compound Name | N-[4-[(3,4-dimethylphenyl)sulfamoyl]phenyl]-2-(2-phenylethoxy)benzamide |
|---|---|
| PubChem CID | 19628059 |
| Molecular Formula | C29H28N2O4S |
| Molecular Weight | 500.62 g/mol |
| Exact Mass | 500.18 |
| IUPAC Name | N-[4-[(3,4-dimethylphenyl)sulfamoyl]phenyl]-2-(2-phenylethoxy)benzamide |
| SMILES | Cc1ccc(NS(=O)(=O)c2ccc(NC(=O)c3ccccc3OCCc3ccccc3)cc2)cc1C |
| InChI | InChI=1S/C29H28N2O4S/c1-21-12-13-25(20-22(21)2)31-36(33,34)26-16-14-24(15-17-26)30-29(32)27-10-6-7-11-28(27)35-19-18-23-8-4-3-5-9-23/h3-17,20,31H,18-19H2,1-2H3,(H,30,32) |
| InChIKey | JQCMXJJCKHKVGL-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.62 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |