C27H29N3O3S — CID 54781894
N-[(4-benzamido-3-methylphenyl)carbamothioyl]-2-(3-methylbutoxy)benzamide (PubChem CID 54781894) has the molecular formula C27H29N3O3S and a molecular weight of 475.61 g/mol. Its IUPAC name is N-[(4-benzamido-3-methylphenyl)carbamothioyl]-2-(3-methylbutoxy)benzamide.
| Compound Name | N-[(4-benzamido-3-methylphenyl)carbamothioyl]-2-(3-methylbutoxy)benzamide |
|---|---|
| PubChem CID | 54781894 |
| Molecular Formula | C27H29N3O3S |
| Molecular Weight | 475.61 g/mol |
| Exact Mass | 475.19 |
| IUPAC Name | N-[(4-benzamido-3-methylphenyl)carbamothioyl]-2-(3-methylbutoxy)benzamide |
| SMILES | Cc1cc(NC(=S)NC(=O)c2ccccc2OCCC(C)C)ccc1NC(=O)c1ccccc1 |
| InChI | InChI=1S/C27H29N3O3S/c1-18(2)15-16-33-24-12-8-7-11-22(24)26(32)30-27(34)28-21-13-14-23(19(3)17-21)29-25(31)20-9-5-4-6-10-20/h4-14,17-18H,15-16H2,1-3H3,(H,29,31)(H2,28,30,32,34) |
| InChIKey | OXFXOACBFNPAIT-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.61 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|