C25H25Cl2N3O4S2 — CID 3256034
4-(2,4-dichlorophenoxy)-N-[[4-[(2,4-dimethylphenyl)sulfamoyl]phenyl]carbamothioyl]butanamide (PubChem CID 3256034) has the molecular formula C25H25Cl2N3O4S2 and a molecular weight of 566.53 g/mol. Its IUPAC name is 4-(2,4-dichlorophenoxy)-N-[[4-[(2,4-dimethylphenyl)sulfamoyl]phenyl]carbamothioyl]butanamide.
| Compound Name | 4-(2,4-dichlorophenoxy)-N-[[4-[(2,4-dimethylphenyl)sulfamoyl]phenyl]carbamothioyl]butanamide |
|---|---|
| PubChem CID | 3256034 |
| Molecular Formula | C25H25Cl2N3O4S2 |
| Molecular Weight | 566.53 g/mol |
| Exact Mass | 565.07 |
| IUPAC Name | 4-(2,4-dichlorophenoxy)-N-[[4-[(2,4-dimethylphenyl)sulfamoyl]phenyl]carbamothioyl]butanamide |
| SMILES | Cc1ccc(NS(=O)(=O)c2ccc(NC(=S)NC(=O)CCCOc3ccc(Cl)cc3Cl)cc2)c(C)c1 |
| InChI | InChI=1S/C25H25Cl2N3O4S2/c1-16-5-11-22(17(2)14-16)30-36(32,33)20-9-7-19(8-10-20)28-25(35)29-24(31)4-3-13-34-23-12-6-18(26)15-21(23)27/h5-12,14-15,30H,3-4,13H2,1-2H3,(H2,28,29,31,35) |
| InChIKey | WDKXXDASDOMBRB-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.53 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|