C18H18Cl2N2O6S — CID 25120990
methyl N-[4-[4-(2,4-dichlorophenoxy)butanoylamino]phenyl]sulfonylcarbamate (PubChem CID 25120990) has the molecular formula C18H18Cl2N2O6S and a molecular weight of 461.32 g/mol. Its IUPAC name is methyl N-[4-[4-(2,4-dichlorophenoxy)butanoylamino]phenyl]sulfonylcarbamate.
| Compound Name | methyl N-[4-[4-(2,4-dichlorophenoxy)butanoylamino]phenyl]sulfonylcarbamate |
|---|---|
| PubChem CID | 25120990 |
| Molecular Formula | C18H18Cl2N2O6S |
| Molecular Weight | 461.32 g/mol |
| Exact Mass | 460.03 |
| IUPAC Name | methyl N-[4-[4-(2,4-dichlorophenoxy)butanoylamino]phenyl]sulfonylcarbamate |
| SMILES | COC(=O)NS(=O)(=O)c1ccc(NC(=O)CCCOc2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C18H18Cl2N2O6S/c1-27-18(24)22-29(25,26)14-7-5-13(6-8-14)21-17(23)3-2-10-28-16-9-4-12(19)11-15(16)20/h4-9,11H,2-3,10H2,1H3,(H,21,23)(H,22,24) |
| InChIKey | PSKGSBYNWVFJBV-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.32 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|