C24H27N5O5S2 — CID 54783133
N-[[4-[(3-methoxypyrazin-2-yl)sulfamoyl]phenyl]carbamothioyl]-2-(3-methylbutoxy)benzamide (PubChem CID 54783133) has the molecular formula C24H27N5O5S2 and a molecular weight of 529.64 g/mol. Its IUPAC name is N-[[4-[(3-methoxypyrazin-2-yl)sulfamoyl]phenyl]carbamothioyl]-2-(3-methylbutoxy)benzamide.
| Compound Name | N-[[4-[(3-methoxypyrazin-2-yl)sulfamoyl]phenyl]carbamothioyl]-2-(3-methylbutoxy)benzamide |
|---|---|
| PubChem CID | 54783133 |
| Molecular Formula | C24H27N5O5S2 |
| Molecular Weight | 529.64 g/mol |
| Exact Mass | 529.15 |
| IUPAC Name | N-[[4-[(3-methoxypyrazin-2-yl)sulfamoyl]phenyl]carbamothioyl]-2-(3-methylbutoxy)benzamide |
| SMILES | COc1nccnc1NS(=O)(=O)c1ccc(NC(=S)NC(=O)c2ccccc2OCCC(C)C)cc1 |
| InChI | InChI=1S/C24H27N5O5S2/c1-16(2)12-15-34-20-7-5-4-6-19(20)22(30)28-24(35)27-17-8-10-18(11-9-17)36(31,32)29-21-23(33-3)26-14-13-25-21/h4-11,13-14,16H,12,15H2,1-3H3,(H,25,29)(H2,27,28,30,35) |
| InChIKey | MBMFVKCRQJOSMS-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 131.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.64 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|