C21H21N5O5S2 — CID 54783109
3-ethoxy-N-[[4-[(3-methoxypyrazin-2-yl)sulfamoyl]phenyl]carbamothioyl]benzamide (PubChem CID 54783109) has the molecular formula C21H21N5O5S2 and a molecular weight of 487.56 g/mol. Its IUPAC name is 3-ethoxy-N-[[4-[(3-methoxypyrazin-2-yl)sulfamoyl]phenyl]carbamothioyl]benzamide.
| Compound Name | 3-ethoxy-N-[[4-[(3-methoxypyrazin-2-yl)sulfamoyl]phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 54783109 |
| Molecular Formula | C21H21N5O5S2 |
| Molecular Weight | 487.56 g/mol |
| Exact Mass | 487.10 |
| IUPAC Name | 3-ethoxy-N-[[4-[(3-methoxypyrazin-2-yl)sulfamoyl]phenyl]carbamothioyl]benzamide |
| SMILES | CCOc1cccc(C(=O)NC(=S)Nc2ccc(S(=O)(=O)Nc3nccnc3OC)cc2)c1 |
| InChI | InChI=1S/C21H21N5O5S2/c1-3-31-16-6-4-5-14(13-16)19(27)25-21(32)24-15-7-9-17(10-8-15)33(28,29)26-18-20(30-2)23-12-11-22-18/h4-13H,3H2,1-2H3,(H,22,26)(H2,24,25,27,32) |
| InChIKey | VKIPURDZENLISK-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 131.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.56 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|