C30H29NO6S — CID 59263291
2-[[4-[2-(4-phenoxy-2-propylphenoxy)ethyl]phenyl]sulfonylamino]benzoic acid (PubChem CID 59263291) has the molecular formula C30H29NO6S and a molecular weight of 531.63 g/mol. Its IUPAC name is 2-[[4-[2-(4-phenoxy-2-propylphenoxy)ethyl]phenyl]sulfonylamino]benzoic acid.
| Compound Name | 2-[[4-[2-(4-phenoxy-2-propylphenoxy)ethyl]phenyl]sulfonylamino]benzoic acid |
|---|---|
| PubChem CID | 59263291 |
| Molecular Formula | C30H29NO6S |
| Molecular Weight | 531.63 g/mol |
| Exact Mass | 531.17 |
| IUPAC Name | 2-[[4-[2-(4-phenoxy-2-propylphenoxy)ethyl]phenyl]sulfonylamino]benzoic acid |
| SMILES | CCCc1cc(Oc2ccccc2)ccc1OCCc1ccc(S(=O)(=O)Nc2ccccc2C(=O)O)cc1 |
| InChI | InChI=1S/C30H29NO6S/c1-2-8-23-21-25(37-24-9-4-3-5-10-24)15-18-29(23)36-20-19-22-13-16-26(17-14-22)38(34,35)31-28-12-7-6-11-27(28)30(32)33/h3-7,9-18,21,31H,2,8,19-20H2,1H3,(H,32,33) |
| InChIKey | UKCDYUCWRTWIEZ-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.63 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |