C28H31NO6S2 — CID 10218262
(2R)-1-[4-[2-(4-phenoxy-2-propylphenoxy)ethylsulfanyl]phenyl]sulfonylpyrrolidine-2-carboxylic acid (PubChem CID 10218262) has the molecular formula C28H31NO6S2 and a molecular weight of 541.69 g/mol. Its IUPAC name is (2R)-1-[4-[2-(4-phenoxy-2-propylphenoxy)ethylsulfanyl]phenyl]sulfonylpyrrolidine-2-carboxylic acid.
| Compound Name | (2R)-1-[4-[2-(4-phenoxy-2-propylphenoxy)ethylsulfanyl]phenyl]sulfonylpyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 10218262 |
| Molecular Formula | C28H31NO6S2 |
| Molecular Weight | 541.69 g/mol |
| Exact Mass | 541.16 |
| IUPAC Name | (2R)-1-[4-[2-(4-phenoxy-2-propylphenoxy)ethylsulfanyl]phenyl]sulfonylpyrrolidine-2-carboxylic acid |
| SMILES | CCCc1cc(Oc2ccccc2)ccc1OCCSc1ccc(S(=O)(=O)N2CCC[C@@H]2C(=O)O)cc1 |
| InChI | InChI=1S/C28H31NO6S2/c1-2-7-21-20-23(35-22-8-4-3-5-9-22)11-16-27(21)34-18-19-36-24-12-14-25(15-13-24)37(32,33)29-17-6-10-26(29)28(30)31/h3-5,8-9,11-16,20,26H,2,6-7,10,17-19H2,1H3,(H,30,31)/t26-/m1/s1 |
| InChIKey | KVLLJFQXVOZBEZ-AREMUKBSSA-N |
| XLogP | 5.84 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.69 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|