C20H23NO5S — CID 11784077
(3R)-2-(4-butoxyphenyl)sulfonyl-3,4-dihydro-1H-isoquinoline-3-carboxylic acid (PubChem CID 11784077) has the molecular formula C20H23NO5S and a molecular weight of 389.47 g/mol. Its IUPAC name is (3R)-2-(4-butoxyphenyl)sulfonyl-3,4-dihydro-1H-isoquinoline-3-carboxylic acid.
| Compound Name | (3R)-2-(4-butoxyphenyl)sulfonyl-3,4-dihydro-1H-isoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 11784077 |
| Molecular Formula | C20H23NO5S |
| Molecular Weight | 389.47 g/mol |
| Exact Mass | 389.13 |
| IUPAC Name | (3R)-2-(4-butoxyphenyl)sulfonyl-3,4-dihydro-1H-isoquinoline-3-carboxylic acid |
| SMILES | CCCCOc1ccc(S(=O)(=O)N2Cc3ccccc3C[C@@H]2C(=O)O)cc1 |
| InChI | InChI=1S/C20H23NO5S/c1-2-3-12-26-17-8-10-18(11-9-17)27(24,25)21-14-16-7-5-4-6-15(16)13-19(21)20(22)23/h4-11,19H,2-3,12-14H2,1H3,(H,22,23)/t19-/m1/s1 |
| InChIKey | WSLKWKCTILPEGB-LJQANCHMSA-N |
| XLogP | 3.07 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.47 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|