C24H21NO4S — CID 10526110
(3R)-2-[4-[(E)-2-phenylethenyl]phenyl]sulfonyl-3,4-dihydro-1H-isoquinoline-3-carboxylic acid (PubChem CID 10526110) has the molecular formula C24H21NO4S and a molecular weight of 419.50 g/mol. Its IUPAC name is (3R)-2-[4-[(E)-2-phenylethenyl]phenyl]sulfonyl-3,4-dihydro-1H-isoquinoline-3-carboxylic acid.
| Compound Name | (3R)-2-[4-[(E)-2-phenylethenyl]phenyl]sulfonyl-3,4-dihydro-1H-isoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 10526110 |
| Molecular Formula | C24H21NO4S |
| Molecular Weight | 419.50 g/mol |
| Exact Mass | 419.12 |
| IUPAC Name | (3R)-2-[4-[(E)-2-phenylethenyl]phenyl]sulfonyl-3,4-dihydro-1H-isoquinoline-3-carboxylic acid |
| SMILES | O=C(O)[C@H]1Cc2ccccc2CN1S(=O)(=O)c1ccc(/C=C/c2ccccc2)cc1 |
| InChI | InChI=1S/C24H21NO4S/c26-24(27)23-16-20-8-4-5-9-21(20)17-25(23)30(28,29)22-14-12-19(13-15-22)11-10-18-6-2-1-3-7-18/h1-15,23H,16-17H2,(H,26,27)/b11-10+/t23-/m1/s1 |
| InChIKey | DORCFHIWOXKYAO-BREAQWACSA-N |
| XLogP | 4.06 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.50 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|