C32H39NO8S — CID 69352510
[(2R)-1-[4-[3-(4-phenoxy-2-propylphenoxy)propoxy]-3-propylphenyl]sulfonylpyrrolidin-2-yl] hydrogen carbonate (PubChem CID 69352510) has the molecular formula C32H39NO8S and a molecular weight of 597.73 g/mol. Its IUPAC name is [(2R)-1-[4-[3-(4-phenoxy-2-propylphenoxy)propoxy]-3-propylphenyl]sulfonylpyrrolidin-2-yl] hydrogen carbonate.
| Compound Name | [(2R)-1-[4-[3-(4-phenoxy-2-propylphenoxy)propoxy]-3-propylphenyl]sulfonylpyrrolidin-2-yl] hydrogen carbonate |
|---|---|
| PubChem CID | 69352510 |
| Molecular Formula | C32H39NO8S |
| Molecular Weight | 597.73 g/mol |
| Exact Mass | 597.24 |
| IUPAC Name | [(2R)-1-[4-[3-(4-phenoxy-2-propylphenoxy)propoxy]-3-propylphenyl]sulfonylpyrrolidin-2-yl] hydrogen carbonate |
| SMILES | CCCc1cc(Oc2ccccc2)ccc1OCCCOc1ccc(S(=O)(=O)N2CCC[C@H]2OC(=O)O)cc1CCC |
| InChI | InChI=1S/C32H39NO8S/c1-3-10-24-22-27(40-26-12-6-5-7-13-26)15-17-29(24)38-20-9-21-39-30-18-16-28(23-25(30)11-4-2)42(36,37)33-19-8-14-31(33)41-32(34)35/h5-7,12-13,15-18,22-23,31H,3-4,8-11,14,19-21H2,1-2H3,(H,34,35)/t31-/m1/s1 |
| InChIKey | HWZSUSQKOMIKPY-WJOKGBTCSA-N |
| XLogP | 7.04 |
| TPSA | 111.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.73 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|