C33H40O4S — CID 142034748
S-[3-methyl-2-oxo-1-[3-[5-(4-phenoxy-2-propylphenoxy)pentyl]phenyl]butyl] ethanethioate (PubChem CID 142034748) has the molecular formula C33H40O4S and a molecular weight of 532.75 g/mol. Its IUPAC name is S-[3-methyl-2-oxo-1-[3-[5-(4-phenoxy-2-propylphenoxy)pentyl]phenyl]butyl] ethanethioate.
| Compound Name | S-[3-methyl-2-oxo-1-[3-[5-(4-phenoxy-2-propylphenoxy)pentyl]phenyl]butyl] ethanethioate |
|---|---|
| PubChem CID | 142034748 |
| Molecular Formula | C33H40O4S |
| Molecular Weight | 532.75 g/mol |
| Exact Mass | 532.26 |
| IUPAC Name | S-[3-methyl-2-oxo-1-[3-[5-(4-phenoxy-2-propylphenoxy)pentyl]phenyl]butyl] ethanethioate |
| SMILES | CCCc1cc(Oc2ccccc2)ccc1OCCCCCc1cccc(C(SC(C)=O)C(=O)C(C)C)c1 |
| InChI | InChI=1S/C33H40O4S/c1-5-13-27-23-30(37-29-17-9-6-10-18-29)19-20-31(27)36-21-11-7-8-14-26-15-12-16-28(22-26)33(38-25(4)34)32(35)24(2)3/h6,9-10,12,15-20,22-24,33H,5,7-8,11,13-14,21H2,1-4H3 |
| InChIKey | NGGXALJHBUYMAJ-UHFFFAOYSA-N |
| XLogP | 8.77 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.75 |
| LogP ≤ 5 | 8.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|