C27H30O5 — CID 18443271
2-methoxy-3-[3-[5-(4-phenoxyphenoxy)pentyl]phenyl]propanoic acid (PubChem CID 18443271) has the molecular formula C27H30O5 and a molecular weight of 434.53 g/mol. Its IUPAC name is 2-methoxy-3-[3-[5-(4-phenoxyphenoxy)pentyl]phenyl]propanoic acid.
| Compound Name | 2-methoxy-3-[3-[5-(4-phenoxyphenoxy)pentyl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 18443271 |
| Molecular Formula | C27H30O5 |
| Molecular Weight | 434.53 g/mol |
| Exact Mass | 434.21 |
| IUPAC Name | 2-methoxy-3-[3-[5-(4-phenoxyphenoxy)pentyl]phenyl]propanoic acid |
| SMILES | COC(Cc1cccc(CCCCCOc2ccc(Oc3ccccc3)cc2)c1)C(=O)O |
| InChI | InChI=1S/C27H30O5/c1-30-26(27(28)29)20-22-11-8-10-21(19-22)9-4-3-7-18-31-23-14-16-25(17-15-23)32-24-12-5-2-6-13-24/h2,5-6,8,10-17,19,26H,3-4,7,9,18,20H2,1H3,(H,28,29) |
| InChIKey | WHMIFNLDVKYILP-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.53 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|