C28H30O6 — CID 18443418
2-methoxy-3-[4-[3-(4-phenoxyphenoxy)propoxy]-3-prop-2-enylphenyl]propanoic acid (PubChem CID 18443418) has the molecular formula C28H30O6 and a molecular weight of 462.54 g/mol. Its IUPAC name is 2-methoxy-3-[4-[3-(4-phenoxyphenoxy)propoxy]-3-prop-2-enylphenyl]propanoic acid.
| Compound Name | 2-methoxy-3-[4-[3-(4-phenoxyphenoxy)propoxy]-3-prop-2-enylphenyl]propanoic acid |
|---|---|
| PubChem CID | 18443418 |
| Molecular Formula | C28H30O6 |
| Molecular Weight | 462.54 g/mol |
| Exact Mass | 462.20 |
| IUPAC Name | 2-methoxy-3-[4-[3-(4-phenoxyphenoxy)propoxy]-3-prop-2-enylphenyl]propanoic acid |
| SMILES | C=CCc1cc(CC(OC)C(=O)O)ccc1OCCCOc1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C28H30O6/c1-3-8-22-19-21(20-27(31-2)28(29)30)11-16-26(22)33-18-7-17-32-23-12-14-25(15-13-23)34-24-9-5-4-6-10-24/h3-6,9-16,19,27H,1,7-8,17-18,20H2,2H3,(H,29,30) |
| InChIKey | LEKCISHJRBCPJW-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.54 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|