C26H24ClO6- — CID 58822800
(2S)-3-[4-[3-(4-benzoylphenoxy)propoxy]-3-chlorophenyl]-2-methoxypropanoate (PubChem CID 58822800) has the molecular formula C26H24ClO6- and a molecular weight of 467.93 g/mol. Its IUPAC name is (2S)-3-[4-[3-(4-benzoylphenoxy)propoxy]-3-chlorophenyl]-2-methoxypropanoate.
| Compound Name | (2S)-3-[4-[3-(4-benzoylphenoxy)propoxy]-3-chlorophenyl]-2-methoxypropanoate |
|---|---|
| PubChem CID | 58822800 |
| Molecular Formula | C26H24ClO6- |
| Molecular Weight | 467.93 g/mol |
| Exact Mass | 467.13 |
| IUPAC Name | (2S)-3-[4-[3-(4-benzoylphenoxy)propoxy]-3-chlorophenyl]-2-methoxypropanoate |
| SMILES | CO[C@@H](Cc1ccc(OCCCOc2ccc(C(=O)c3ccccc3)cc2)c(Cl)c1)C(=O)[O-] |
| InChI | InChI=1S/C26H25ClO6/c1-31-24(26(29)30)17-18-8-13-23(22(27)16-18)33-15-5-14-32-21-11-9-20(10-12-21)25(28)19-6-3-2-4-7-19/h2-4,6-13,16,24H,5,14-15,17H2,1H3,(H,29,30)/p-1/t24-/m0/s1 |
| InChIKey | XCVUGMYZFJHTQE-DEOSSOPVSA-M |
| XLogP | 3.73 |
| TPSA | 84.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.93 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|