C26H28O5 — CID 18443550
2-methoxy-3-[4-[4-(4-phenylphenoxy)butoxy]phenyl]propanoic acid (PubChem CID 18443550) has the molecular formula C26H28O5 and a molecular weight of 420.51 g/mol. Its IUPAC name is 2-methoxy-3-[4-[4-(4-phenylphenoxy)butoxy]phenyl]propanoic acid.
| Compound Name | 2-methoxy-3-[4-[4-(4-phenylphenoxy)butoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 18443550 |
| Molecular Formula | C26H28O5 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.19 |
| IUPAC Name | 2-methoxy-3-[4-[4-(4-phenylphenoxy)butoxy]phenyl]propanoic acid |
| SMILES | COC(Cc1ccc(OCCCCOc2ccc(-c3ccccc3)cc2)cc1)C(=O)O |
| InChI | InChI=1S/C26H28O5/c1-29-25(26(27)28)19-20-9-13-23(14-10-20)30-17-5-6-18-31-24-15-11-22(12-16-24)21-7-3-2-4-8-21/h2-4,7-16,25H,5-6,17-19H2,1H3,(H,27,28) |
| InChIKey | OPHUOAPFTLHMDA-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|