C29H34O5 — CID 18443221
3-[4-[3-[4-(4-tert-butylphenyl)phenoxy]propoxy]phenyl]-2-methoxypropanoic acid (PubChem CID 18443221) has the molecular formula C29H34O5 and a molecular weight of 462.59 g/mol. Its IUPAC name is 3-[4-[3-[4-(4-tert-butylphenyl)phenoxy]propoxy]phenyl]-2-methoxypropanoic acid.
| Compound Name | 3-[4-[3-[4-(4-tert-butylphenyl)phenoxy]propoxy]phenyl]-2-methoxypropanoic acid |
|---|---|
| PubChem CID | 18443221 |
| Molecular Formula | C29H34O5 |
| Molecular Weight | 462.59 g/mol |
| Exact Mass | 462.24 |
| IUPAC Name | 3-[4-[3-[4-(4-tert-butylphenyl)phenoxy]propoxy]phenyl]-2-methoxypropanoic acid |
| SMILES | COC(Cc1ccc(OCCCOc2ccc(-c3ccc(C(C)(C)C)cc3)cc2)cc1)C(=O)O |
| InChI | InChI=1S/C29H34O5/c1-29(2,3)24-12-8-22(9-13-24)23-10-16-26(17-11-23)34-19-5-18-33-25-14-6-21(7-15-25)20-27(32-4)28(30)31/h6-17,27H,5,18-20H2,1-4H3,(H,30,31) |
| InChIKey | DCQLFDFFRYZYLG-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.59 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|