C23H29NO6 — CID 58822714
(2S)-3-[4-[2-[4-(2,2-dimethylpropanoylamino)phenoxy]ethoxy]phenyl]-2-methoxypropanoic acid (PubChem CID 58822714) has the molecular formula C23H29NO6 and a molecular weight of 415.49 g/mol. Its IUPAC name is (2S)-3-[4-[2-[4-(2,2-dimethylpropanoylamino)phenoxy]ethoxy]phenyl]-2-methoxypropanoic acid.
| Compound Name | (2S)-3-[4-[2-[4-(2,2-dimethylpropanoylamino)phenoxy]ethoxy]phenyl]-2-methoxypropanoic acid |
|---|---|
| PubChem CID | 58822714 |
| Molecular Formula | C23H29NO6 |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.20 |
| IUPAC Name | (2S)-3-[4-[2-[4-(2,2-dimethylpropanoylamino)phenoxy]ethoxy]phenyl]-2-methoxypropanoic acid |
| SMILES | CO[C@@H](Cc1ccc(OCCOc2ccc(NC(=O)C(C)(C)C)cc2)cc1)C(=O)O |
| InChI | InChI=1S/C23H29NO6/c1-23(2,3)22(27)24-17-7-11-19(12-8-17)30-14-13-29-18-9-5-16(6-10-18)15-20(28-4)21(25)26/h5-12,20H,13-15H2,1-4H3,(H,24,27)(H,25,26)/t20-/m0/s1 |
| InChIKey | DEWGEXHKEONXLE-FQEVSTJZSA-N |
| XLogP | 3.77 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|