C19H31NO6 — CID 58408889
N-[4-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]phenyl]-2,2-dimethylpropanamide (PubChem CID 58408889) has the molecular formula C19H31NO6 and a molecular weight of 369.46 g/mol. Its IUPAC name is N-[4-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]phenyl]-2,2-dimethylpropanamide.
| Compound Name | N-[4-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]phenyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 58408889 |
| Molecular Formula | C19H31NO6 |
| Molecular Weight | 369.46 g/mol |
| Exact Mass | 369.22 |
| IUPAC Name | N-[4-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]phenyl]-2,2-dimethylpropanamide |
| SMILES | CC(C)(C)C(=O)Nc1ccc(OCCOCCOCCOCCO)cc1 |
| InChI | InChI=1S/C19H31NO6/c1-19(2,3)18(22)20-16-4-6-17(7-5-16)26-15-14-25-13-12-24-11-10-23-9-8-21/h4-7,21H,8-15H2,1-3H3,(H,20,22) |
| InChIKey | ZBUKMNLABPIMRY-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 86.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.46 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|