C21H28O5 — CID 15607829
2-[2-[4-[2-[4-(2-hydroxyethoxy)phenyl]propan-2-yl]phenoxy]ethoxy]ethanol (PubChem CID 15607829) has the molecular formula C21H28O5 and a molecular weight of 360.45 g/mol. Its IUPAC name is 2-[2-[4-[2-[4-(2-hydroxyethoxy)phenyl]propan-2-yl]phenoxy]ethoxy]ethanol.
| Compound Name | 2-[2-[4-[2-[4-(2-hydroxyethoxy)phenyl]propan-2-yl]phenoxy]ethoxy]ethanol |
|---|---|
| PubChem CID | 15607829 |
| Molecular Formula | C21H28O5 |
| Molecular Weight | 360.45 g/mol |
| Exact Mass | 360.19 |
| IUPAC Name | 2-[2-[4-[2-[4-(2-hydroxyethoxy)phenyl]propan-2-yl]phenoxy]ethoxy]ethanol |
| SMILES | CC(C)(c1ccc(OCCO)cc1)c1ccc(OCCOCCO)cc1 |
| InChI | InChI=1S/C21H28O5/c1-21(2,17-3-7-19(8-4-17)25-14-12-23)18-5-9-20(10-6-18)26-16-15-24-13-11-22/h3-10,22-23H,11-16H2,1-2H3 |
| InChIKey | FLQCMZIWPDTMGO-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.45 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|