C23H32O5 — CID 176854878
2-[2-[4-[2-[4-(2-ethoxyethoxy)phenyl]propan-2-yl]phenoxy]ethoxy]ethanol (PubChem CID 176854878) has the molecular formula C23H32O5 and a molecular weight of 388.50 g/mol. Its IUPAC name is 2-[2-[4-[2-[4-(2-ethoxyethoxy)phenyl]propan-2-yl]phenoxy]ethoxy]ethanol.
| Compound Name | 2-[2-[4-[2-[4-(2-ethoxyethoxy)phenyl]propan-2-yl]phenoxy]ethoxy]ethanol |
|---|---|
| PubChem CID | 176854878 |
| Molecular Formula | C23H32O5 |
| Molecular Weight | 388.50 g/mol |
| Exact Mass | 388.22 |
| IUPAC Name | 2-[2-[4-[2-[4-(2-ethoxyethoxy)phenyl]propan-2-yl]phenoxy]ethoxy]ethanol |
| SMILES | CCOCCOc1ccc(C(C)(C)c2ccc(OCCOCCO)cc2)cc1 |
| InChI | InChI=1S/C23H32O5/c1-4-25-15-17-27-21-9-5-19(6-10-21)23(2,3)20-7-11-22(12-8-20)28-18-16-26-14-13-24/h5-12,24H,4,13-18H2,1-3H3 |
| InChIKey | AGSQNYPSNGKCAA-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.50 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|