C25H36O6 — CID 90381423
(2R)-1-[4-[2-[4-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]phenyl]propan-2-yl]phenoxy]butan-2-ol (PubChem CID 90381423) has the molecular formula C25H36O6 and a molecular weight of 432.56 g/mol. Its IUPAC name is (2R)-1-[4-[2-[4-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]phenyl]propan-2-yl]phenoxy]butan-2-ol.
| Compound Name | (2R)-1-[4-[2-[4-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]phenyl]propan-2-yl]phenoxy]butan-2-ol |
|---|---|
| PubChem CID | 90381423 |
| Molecular Formula | C25H36O6 |
| Molecular Weight | 432.56 g/mol |
| Exact Mass | 432.25 |
| IUPAC Name | (2R)-1-[4-[2-[4-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]phenyl]propan-2-yl]phenoxy]butan-2-ol |
| SMILES | CC[C@@H](O)COc1ccc(C(C)(C)c2ccc(OCCOCCOCCO)cc2)cc1 |
| InChI | InChI=1S/C25H36O6/c1-4-22(27)19-31-24-11-7-21(8-12-24)25(2,3)20-5-9-23(10-6-20)30-18-17-29-16-15-28-14-13-26/h5-12,22,26-27H,4,13-19H2,1-3H3/t22-/m1/s1 |
| InChIKey | DCNWETBKHXYDKI-JOCHJYFZSA-N |
| XLogP | 3.57 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.56 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|