C22H31O5+ — CID 147647017
1-[4-[2-[4-(2,3-dihydroxypropoxy)phenyl]propan-2-yl]phenoxy]butan-2-yloxidanium (PubChem CID 147647017) has the molecular formula C22H31O5+ and a molecular weight of 375.49 g/mol. Its IUPAC name is 1-[4-[2-[4-(2,3-dihydroxypropoxy)phenyl]propan-2-yl]phenoxy]butan-2-yloxidanium.
| Compound Name | 1-[4-[2-[4-(2,3-dihydroxypropoxy)phenyl]propan-2-yl]phenoxy]butan-2-yloxidanium |
|---|---|
| PubChem CID | 147647017 |
| Molecular Formula | C22H31O5+ |
| Molecular Weight | 375.49 g/mol |
| Exact Mass | 375.22 |
| IUPAC Name | 1-[4-[2-[4-(2,3-dihydroxypropoxy)phenyl]propan-2-yl]phenoxy]butan-2-yloxidanium |
| SMILES | CCC([OH2+])COc1ccc(C(C)(C)c2ccc(OCC(O)CO)cc2)cc1 |
| InChI | InChI=1S/C22H30O5/c1-4-18(24)14-26-20-9-5-16(6-10-20)22(2,3)17-7-11-21(12-8-17)27-15-19(25)13-23/h5-12,18-19,23-25H,4,13-15H2,1-3H3/p+1 |
| InChIKey | GITJWJHZTSLTTC-UHFFFAOYSA-O |
| XLogP | 2.63 |
| TPSA | 81.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.49 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|