C21H27AcO5- — CID 59110852
actinium;3-[4-[2-[4-(2-hydroxypropoxy)phenyl]propan-2-yl]phenoxy]propane-1,2-diol (PubChem CID 59110852) has the molecular formula C21H27AcO5- and a molecular weight of 586.44 g/mol. Its IUPAC name is actinium;3-[4-[2-[4-(2-hydroxypropoxy)phenyl]propan-2-yl]phenoxy]propane-1,2-diol.
| Compound Name | actinium;3-[4-[2-[4-(2-hydroxypropoxy)phenyl]propan-2-yl]phenoxy]propane-1,2-diol |
|---|---|
| PubChem CID | 59110852 |
| Molecular Formula | C21H27AcO5- |
| Molecular Weight | 586.44 g/mol |
| Exact Mass | 586.21 |
| IUPAC Name | actinium;3-[4-[2-[4-(2-hydroxypropoxy)phenyl]propan-2-yl]phenoxy]propane-1,2-diol |
| SMILES | [Ac].[CH2-]C(O)COc1ccc(C(C)(C)c2ccc(OCC(O)CO)cc2)cc1 |
| InChI | InChI=1S/C21H27O5.Ac/c1-15(23)13-25-19-8-4-16(5-9-19)21(2,3)17-6-10-20(11-7-17)26-14-18(24)12-22;/h4-11,15,18,22-24H,1,12-14H2,2-3H3;/q-1; |
| InChIKey | OBJTWJBJIQEGJA-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.44 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|