C21H28FO4P — CID 143919875
1-fluoro-3-[4-[2-[4-(2-hydroxy-3-phosphanylpropoxy)phenyl]propan-2-yl]phenoxy]propan-2-ol (PubChem CID 143919875) has the molecular formula C21H28FO4P and a molecular weight of 394.42 g/mol. Its IUPAC name is 1-fluoro-3-[4-[2-[4-(2-hydroxy-3-phosphanylpropoxy)phenyl]propan-2-yl]phenoxy]propan-2-ol.
| Compound Name | 1-fluoro-3-[4-[2-[4-(2-hydroxy-3-phosphanylpropoxy)phenyl]propan-2-yl]phenoxy]propan-2-ol |
|---|---|
| PubChem CID | 143919875 |
| Molecular Formula | C21H28FO4P |
| Molecular Weight | 394.42 g/mol |
| Exact Mass | 394.17 |
| IUPAC Name | 1-fluoro-3-[4-[2-[4-(2-hydroxy-3-phosphanylpropoxy)phenyl]propan-2-yl]phenoxy]propan-2-ol |
| SMILES | CC(C)(c1ccc(OCC(O)CF)cc1)c1ccc(OCC(O)CP)cc1 |
| InChI | InChI=1S/C21H28FO4P/c1-21(2,15-3-7-19(8-4-15)25-12-17(23)11-22)16-5-9-20(10-6-16)26-13-18(24)14-27/h3-10,17-18,23-24H,11-14,27H2,1-2H3 |
| InChIKey | ZKDYDBSZQWCPOL-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.42 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|