C35H36O8 — CID 100967393
4-[3-[4-[2-[4-[3-(4-formylphenoxy)-2-hydroxypropoxy]phenyl]propan-2-yl]phenoxy]-2-hydroxypropoxy]benzaldehyde (PubChem CID 100967393) has the molecular formula C35H36O8 and a molecular weight of 584.67 g/mol. Its IUPAC name is 4-[3-[4-[2-[4-[3-(4-formylphenoxy)-2-hydroxypropoxy]phenyl]propan-2-yl]phenoxy]-2-hydroxypropoxy]benzaldehyde.
| Compound Name | 4-[3-[4-[2-[4-[3-(4-formylphenoxy)-2-hydroxypropoxy]phenyl]propan-2-yl]phenoxy]-2-hydroxypropoxy]benzaldehyde |
|---|---|
| PubChem CID | 100967393 |
| Molecular Formula | C35H36O8 |
| Molecular Weight | 584.67 g/mol |
| Exact Mass | 584.24 |
| IUPAC Name | 4-[3-[4-[2-[4-[3-(4-formylphenoxy)-2-hydroxypropoxy]phenyl]propan-2-yl]phenoxy]-2-hydroxypropoxy]benzaldehyde |
| SMILES | CC(C)(c1ccc(OCC(O)COc2ccc(C=O)cc2)cc1)c1ccc(OCC(O)COc2ccc(C=O)cc2)cc1 |
| InChI | InChI=1S/C35H36O8/c1-35(2,27-7-15-33(16-8-27)42-23-29(38)21-40-31-11-3-25(19-36)4-12-31)28-9-17-34(18-10-28)43-24-30(39)22-41-32-13-5-26(20-37)6-14-32/h3-20,29-30,38-39H,21-24H2,1-2H3 |
| InChIKey | ARUGOJYLQZOHTF-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.67 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|