C27H42O5 — CID 143919845
ethane;1-[4-[2-[4-(2-hydroxy-3-propan-2-yloxypropoxy)phenyl]propan-2-yl]phenoxy]butan-2-ol (PubChem CID 143919845) has the molecular formula C27H42O5 and a molecular weight of 446.63 g/mol. Its IUPAC name is ethane;1-[4-[2-[4-(2-hydroxy-3-propan-2-yloxypropoxy)phenyl]propan-2-yl]phenoxy]butan-2-ol.
| Compound Name | ethane;1-[4-[2-[4-(2-hydroxy-3-propan-2-yloxypropoxy)phenyl]propan-2-yl]phenoxy]butan-2-ol |
|---|---|
| PubChem CID | 143919845 |
| Molecular Formula | C27H42O5 |
| Molecular Weight | 446.63 g/mol |
| Exact Mass | 446.30 |
| IUPAC Name | ethane;1-[4-[2-[4-(2-hydroxy-3-propan-2-yloxypropoxy)phenyl]propan-2-yl]phenoxy]butan-2-ol |
| SMILES | CC.CCC(O)COc1ccc(C(C)(C)c2ccc(OCC(O)COC(C)C)cc2)cc1 |
| InChI | InChI=1S/C25H36O5.C2H6/c1-6-21(26)15-29-23-11-7-19(8-12-23)25(4,5)20-9-13-24(14-10-20)30-17-22(27)16-28-18(2)3;1-2/h7-14,18,21-22,26-27H,6,15-17H2,1-5H3;1-2H3 |
| InChIKey | XCERHDWQGLHIJL-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.63 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |