C31H38O5 — CID 157198404
1-[4-[(E)-1-[4-(2-hydroxy-3-propan-2-yloxypropoxy)phenyl]-2-phenylprop-1-enyl]phenoxy]butan-2-ol (PubChem CID 157198404) has the molecular formula C31H38O5 and a molecular weight of 490.64 g/mol. Its IUPAC name is 1-[4-[(E)-1-[4-(2-hydroxy-3-propan-2-yloxypropoxy)phenyl]-2-phenylprop-1-enyl]phenoxy]butan-2-ol.
| Compound Name | 1-[4-[(E)-1-[4-(2-hydroxy-3-propan-2-yloxypropoxy)phenyl]-2-phenylprop-1-enyl]phenoxy]butan-2-ol |
|---|---|
| PubChem CID | 157198404 |
| Molecular Formula | C31H38O5 |
| Molecular Weight | 490.64 g/mol |
| Exact Mass | 490.27 |
| IUPAC Name | 1-[4-[(E)-1-[4-(2-hydroxy-3-propan-2-yloxypropoxy)phenyl]-2-phenylprop-1-enyl]phenoxy]butan-2-ol |
| SMILES | CCC(O)COc1ccc(/C(=C(/C)c2ccccc2)c2ccc(OCC(O)COC(C)C)cc2)cc1 |
| InChI | InChI=1S/C31H38O5/c1-5-27(32)19-35-29-15-11-25(12-16-29)31(23(4)24-9-7-6-8-10-24)26-13-17-30(18-14-26)36-21-28(33)20-34-22(2)3/h6-18,22,27-28,32-33H,5,19-21H2,1-4H3/b31-23+ |
| InChIKey | BAXOIXVZVACCHF-UQRQXUALSA-N |
| XLogP | 5.98 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.64 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|