C27H31NO — CID 145071342
2-[4-[(Z)-1,2-diphenylprop-1-enyl]phenoxy]-N,N-diethylethanamine (PubChem CID 145071342) has the molecular formula C27H31NO and a molecular weight of 385.55 g/mol. Its IUPAC name is 2-[4-[(Z)-1,2-diphenylprop-1-enyl]phenoxy]-N,N-diethylethanamine.
| Compound Name | 2-[4-[(Z)-1,2-diphenylprop-1-enyl]phenoxy]-N,N-diethylethanamine |
|---|---|
| PubChem CID | 145071342 |
| Molecular Formula | C27H31NO |
| Molecular Weight | 385.55 g/mol |
| Exact Mass | 385.24 |
| IUPAC Name | 2-[4-[(Z)-1,2-diphenylprop-1-enyl]phenoxy]-N,N-diethylethanamine |
| SMILES | CCN(CC)CCOc1ccc(/C(=C(/C)c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C27H31NO/c1-4-28(5-2)20-21-29-26-18-16-25(17-19-26)27(24-14-10-7-11-15-24)22(3)23-12-8-6-9-13-23/h6-19H,4-5,20-21H2,1-3H3/b27-22- |
| InChIKey | UKEYEUYIUIALKO-QYQHSDTDSA-N |
| XLogP | 6.39 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.55 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|