C27H32N2O — CID 54115203
3-[4-[2-(diethylamino)ethoxy]phenyl]-2,3-diphenylprop-2-en-1-amine (PubChem CID 54115203) has the molecular formula C27H32N2O and a molecular weight of 400.57 g/mol. Its IUPAC name is 3-[4-[2-(diethylamino)ethoxy]phenyl]-2,3-diphenylprop-2-en-1-amine.
| Compound Name | 3-[4-[2-(diethylamino)ethoxy]phenyl]-2,3-diphenylprop-2-en-1-amine |
|---|---|
| PubChem CID | 54115203 |
| Molecular Formula | C27H32N2O |
| Molecular Weight | 400.57 g/mol |
| Exact Mass | 400.25 |
| IUPAC Name | 3-[4-[2-(diethylamino)ethoxy]phenyl]-2,3-diphenylprop-2-en-1-amine |
| SMILES | CCN(CC)CCOc1ccc(C(=C(CN)c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C27H32N2O/c1-3-29(4-2)19-20-30-25-17-15-24(16-18-25)27(23-13-9-6-10-14-23)26(21-28)22-11-7-5-8-12-22/h5-18H,3-4,19-21,28H2,1-2H3 |
| InChIKey | NJVVLNOIODULKQ-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.57 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|