C26H28ClNO2 — CID 71494458
3-[(Z)-2-chloro-1-[4-[2-(diethylamino)ethoxy]phenyl]-2-phenylethenyl]phenol (PubChem CID 71494458) has the molecular formula C26H28ClNO2 and a molecular weight of 421.97 g/mol. Its IUPAC name is 3-[(Z)-2-chloro-1-[4-[2-(diethylamino)ethoxy]phenyl]-2-phenylethenyl]phenol.
| Compound Name | 3-[(Z)-2-chloro-1-[4-[2-(diethylamino)ethoxy]phenyl]-2-phenylethenyl]phenol |
|---|---|
| PubChem CID | 71494458 |
| Molecular Formula | C26H28ClNO2 |
| Molecular Weight | 421.97 g/mol |
| Exact Mass | 421.18 |
| IUPAC Name | 3-[(Z)-2-chloro-1-[4-[2-(diethylamino)ethoxy]phenyl]-2-phenylethenyl]phenol |
| SMILES | CCN(CC)CCOc1ccc(/C(=C(/Cl)c2ccccc2)c2cccc(O)c2)cc1 |
| InChI | InChI=1S/C26H28ClNO2/c1-3-28(4-2)17-18-30-24-15-13-20(14-16-24)25(22-11-8-12-23(29)19-22)26(27)21-9-6-5-7-10-21/h5-16,19,29H,3-4,17-18H2,1-2H3/b26-25- |
| InChIKey | IBLAHVFKXSUJBT-QPLCGJKRSA-N |
| XLogP | 6.27 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.97 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|