C28H32ClNO2 — CID 54155366
3-[1-chloro-2-[4-[4-(diethylamino)butoxy]phenyl]-2-phenylethenyl]phenol (PubChem CID 54155366) has the molecular formula C28H32ClNO2 and a molecular weight of 450.02 g/mol. Its IUPAC name is 3-[1-chloro-2-[4-[4-(diethylamino)butoxy]phenyl]-2-phenylethenyl]phenol.
| Compound Name | 3-[1-chloro-2-[4-[4-(diethylamino)butoxy]phenyl]-2-phenylethenyl]phenol |
|---|---|
| PubChem CID | 54155366 |
| Molecular Formula | C28H32ClNO2 |
| Molecular Weight | 450.02 g/mol |
| Exact Mass | 449.21 |
| IUPAC Name | 3-[1-chloro-2-[4-[4-(diethylamino)butoxy]phenyl]-2-phenylethenyl]phenol |
| SMILES | CCN(CC)CCCCOc1ccc(C(=C(Cl)c2cccc(O)c2)c2ccccc2)cc1 |
| InChI | InChI=1S/C28H32ClNO2/c1-3-30(4-2)19-8-9-20-32-26-17-15-23(16-18-26)27(22-11-6-5-7-12-22)28(29)24-13-10-14-25(31)21-24/h5-7,10-18,21,31H,3-4,8-9,19-20H2,1-2H3 |
| InChIKey | OKRCQVYCJIIMMJ-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.02 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|